About 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate
2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate (PubChem CID 10520512) has the molecular formula C17H17NO4S
and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate |
| PubChem CID | 10520512 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate |
| SMILES | NCCOC(=O)/C(=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17NO4S/c18-11-12-22-17(19)16(13-14-7-3-1-4-8-14)23(20,21)15-9-5-2-6-10-15/h1-10,13H,11-12,18H2/b16-13- |
| InChIKey | SITNSPJRRFMQKK-SSZFMOIBSA-N |
| XLogP | 2.00 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate?
The IUPAC name of 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate (CID 10520512) is 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate.
What is the SMILES notation for 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate?
The canonical SMILES for 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate is NCCOC(=O)/C(=C/c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate?
The InChIKey is SITNSPJRRFMQKK-SSZFMOIBSA-N. The full InChI is InChI=1S/C17H17NO4S/c18-11-12-22-17(19)16(13-14-7-3-1-4-8-14)23(20,21)15-9-5-2-6-10-15/h1-10,13H,11-12,18H2/b16-13-.
What are the key properties of 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate?
2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate has a molecular weight of 331.39 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl (Z)-2-(benzenesulfonyl)-3-phenylprop-2-enoate is sourced from PubChem (CID 10520512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).