C17H16N3O2+ — CID 101351674
2-[(E)-2-(4-methoxyphenyl)ethenyl]-5-(1-methylpyridin-1-ium-4-yl)-1,3,4-oxadiazole (PubChem CID 101351674) has the molecular formula C17H16N3O2+ and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[(E)-2-(4-methoxyphenyl)ethenyl]-5-(1-methylpyridin-1-ium-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-5-(1-methylpyridin-1-ium-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 101351674 |
| Molecular Formula | C17H16N3O2+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[(E)-2-(4-methoxyphenyl)ethenyl]-5-(1-methylpyridin-1-ium-4-yl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(/C=C/c2nnc(-c3cc[n+](C)cc3)o2)cc1 |
| InChI | InChI=1S/C17H16N3O2/c1-20-11-9-14(10-12-20)17-19-18-16(22-17)8-5-13-3-6-15(21-2)7-4-13/h3-12H,1-2H3/q+1/b8-5+ |
| InChIKey | KEZOZIYZHWTINE-VMPITWQZSA-N |
| XLogP | 2.74 |
| TPSA | 52.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|