C12H12O6 — CID 101352865
[(1aS,2S,7R,7aR)-3,6,7-trihydroxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxiren-2-yl] acetate (PubChem CID 101352865) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is [(1aS,2S,7R,7aR)-3,6,7-trihydroxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxiren-2-yl] acetate.
| Compound Name | [(1aS,2S,7R,7aR)-3,6,7-trihydroxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxiren-2-yl] acetate |
|---|---|
| PubChem CID | 101352865 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | [(1aS,2S,7R,7aR)-3,6,7-trihydroxy-1a,2,7,7a-tetrahydronaphtho[2,3-b]oxiren-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1c2c(O)ccc(O)c2[C@@H](O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C12H12O6/c1-4(13)17-10-8-6(15)3-2-5(14)7(8)9(16)11-12(10)18-11/h2-3,9-12,14-16H,1H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | KZTPOTZOJNXNNY-KXNHARMFSA-N |
| XLogP | 0.52 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|