C18H25NO5 — CID 101354366
4-O-tert-butyl 3-O-prop-2-enyl (2S,3S,3aS,7aR)-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3,4-dicarboxylate (PubChem CID 101354366) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-prop-2-enyl (2S,3S,3aS,7aR)-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 3-O-prop-2-enyl (2S,3S,3aS,7aR)-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101354366 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-O-tert-butyl 3-O-prop-2-enyl (2S,3S,3aS,7aR)-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-3,4-dicarboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2[C@@H](C=CCN2C(=O)OC(C)(C)C)O[C@H]1C=C |
| InChI | InChI=1S/C18H25NO5/c1-6-11-22-16(20)14-12(7-2)23-13-9-8-10-19(15(13)14)17(21)24-18(3,4)5/h6-9,12-15H,1-2,10-11H2,3-5H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | VCQYGQAVURPGGT-GBJTYRQASA-N |
| XLogP | 2.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|