(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid

C12H18N2O4 — CID 101354633

IUPAC(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid
SMILESC=CC(=O)NCCCC[C@H](NC(=O)C=C)C(=O)O
InChIInChI=1S/C12H18N2O4/c1-3-10(15)13-8-6-5-7-9(12(17)18)14-11(16)4-2/h3-4,9H,1-2,5-8H2,(H,13,15)(H,14,16)(H,17,18)/t9-/m0/s1
InChIKeyDAFCXKMMHOWGJJ-VIFPVBQESA-N
MW254.29 g/mol
LogP0.21
Rot. Bonds9

About (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid

(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid (PubChem CID 101354633) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid.

Molecular Properties

Compound Name(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid
PubChem CID101354633
Molecular FormulaC12H18N2O4
Molecular Weight254.29 g/mol
Exact Mass254.13
IUPAC Name(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid
SMILESC=CC(=O)NCCCC[C@H](NC(=O)C=C)C(=O)O
InChIInChI=1S/C12H18N2O4/c1-3-10(15)13-8-6-5-7-9(12(17)18)14-11(16)4-2/h3-4,9H,1-2,5-8H2,(H,13,15)(H,14,16)(H,17,18)/t9-/m0/s1
InChIKeyDAFCXKMMHOWGJJ-VIFPVBQESA-N
XLogP0.21
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 50.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid?
The IUPAC name of (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid (CID 101354633) is (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid.
What is the SMILES notation for (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid?
The canonical SMILES for (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid is C=CC(=O)NCCCC[C@H](NC(=O)C=C)C(=O)O.
What is the InChIKey of (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid?
The InChIKey is DAFCXKMMHOWGJJ-VIFPVBQESA-N. The full InChI is InChI=1S/C12H18N2O4/c1-3-10(15)13-8-6-5-7-9(12(17)18)14-11(16)4-2/h3-4,9H,1-2,5-8H2,(H,13,15)(H,14,16)(H,17,18)/t9-/m0/s1.
What are the key properties of (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid?
(2S)-2,6-bis(prop-2-enoylamino)hexanoic acid has a molecular weight of 254.29 g/mol, XLogP of 0.21, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-bis(prop-2-enoylamino)hexanoic acid is sourced from PubChem (CID 101354633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).