C10H18N2O4 — CID 7019608
(2S)-2,6-diacetamidohexanoic acid (PubChem CID 7019608) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2,6-diacetamidohexanoic acid.
| Compound Name | (2S)-2,6-diacetamidohexanoic acid |
|---|---|
| PubChem CID | 7019608 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S)-2,6-diacetamidohexanoic acid |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-7(13)11-6-4-3-5-9(10(15)16)12-8(2)14/h9H,3-6H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | ZHZUEHHBTYJTKY-VIFPVBQESA-N |
| XLogP | -0.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|