C15H30N2O4 — CID 101356131
methyl 3-(diethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 101356131) has the molecular formula C15H30N2O4 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl 3-(diethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl 3-(diethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 101356131 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | methyl 3-(diethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCN(CC)C(CC(=O)OC)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O4/c1-8-17(9-2)12(10-13(18)20-7)11(3)16-14(19)21-15(4,5)6/h11-12H,8-10H2,1-7H3,(H,16,19) |
| InChIKey | GUHMHOXKVJFYNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |