C19H30N2O4 — CID 101356132
methyl 3-(diethylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoate (PubChem CID 101356132) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 3-(diethylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoate.
| Compound Name | methyl 3-(diethylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 101356132 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl 3-(diethylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoate |
| SMILES | CCN(CC)C(CC(=O)OC)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O4/c1-7-21(8-2)16(13-17(22)24-6)14-9-11-15(12-10-14)20-18(23)25-19(3,4)5/h9-12,16H,7-8,13H2,1-6H3,(H,20,23) |
| InChIKey | GYGANRNJTPOMCB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |