C19H32N2O2 — CID 107253386
tert-butyl N-[4-[1-(4-methylpentan-2-ylamino)ethyl]phenyl]carbamate (PubChem CID 107253386) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(4-methylpentan-2-ylamino)ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(4-methylpentan-2-ylamino)ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 107253386 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl N-[4-[1-(4-methylpentan-2-ylamino)ethyl]phenyl]carbamate |
| SMILES | CC(C)CC(C)NC(C)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O2/c1-13(2)12-14(3)20-15(4)16-8-10-17(11-9-16)21-18(22)23-19(5,6)7/h8-11,13-15,20H,12H2,1-7H3,(H,21,22) |
| InChIKey | YYMQUMIFDPAVCA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |