C26H29NO2 — CID 101360672
tert-butyl (3R)-3-(benzhydrylamino)-3-phenylpropanoate (PubChem CID 101360672) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-(benzhydrylamino)-3-phenylpropanoate.
| Compound Name | tert-butyl (3R)-3-(benzhydrylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 101360672 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl (3R)-3-(benzhydrylamino)-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](NC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-26(2,3)29-24(28)19-23(20-13-7-4-8-14-20)27-25(21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23,25,27H,19H2,1-3H3/t23-/m1/s1 |
| InChIKey | HSKWSRROFHEEGH-HSZRJFAPSA-N |
| XLogP | 5.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |