About (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione
(1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione (PubChem CID 101361916) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione.
Molecular Properties
| Compound Name | (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione |
| PubChem CID | 101361916 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione |
| SMILES | C[C@]12C[C@H](CCC1=O)OC2=O |
| InChI | InChI=1S/C8H10O3/c1-8-4-5(11-7(8)10)2-3-6(8)9/h5H,2-4H2,1H3/t5-,8-/m0/s1 |
| InChIKey | QJXXUQACSNJAEJ-XNCJUZBTSA-N |
| XLogP | 0.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione?
The IUPAC name of (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione (CID 101361916) is (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione.
What is the SMILES notation for (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione?
The canonical SMILES for (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione is C[C@]12C[C@H](CCC1=O)OC2=O.
What is the InChIKey of (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione?
The InChIKey is QJXXUQACSNJAEJ-XNCJUZBTSA-N. The full InChI is InChI=1S/C8H10O3/c1-8-4-5(11-7(8)10)2-3-6(8)9/h5H,2-4H2,1H3/t5-,8-/m0/s1.
What are the key properties of (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione?
(1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione has a molecular weight of 154.16 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-1-methyl-6-oxabicyclo[3.2.1]octane-2,7-dione is sourced from PubChem (CID 101361916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).