C30H31NO7 — CID 101361927
[(2S,3S,4S,5R,6R)-2-isocyanato-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 101361927) has the molecular formula C30H31NO7 and a molecular weight of 517.58 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2-isocyanato-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-2-isocyanato-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101361927 |
| Molecular Formula | C30H31NO7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2-isocyanato-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1N=C=O |
| InChI | InChI=1S/C30H31NO7/c1-22(33)37-29-28(36-19-25-15-9-4-10-16-25)27(35-18-24-13-7-3-8-14-24)26(38-30(29)31-21-32)20-34-17-23-11-5-2-6-12-23/h2-16,26-30H,17-20H2,1H3/t26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | QVZPRLMAZKPRBA-ZNOUKXQUSA-N |
| XLogP | 4.37 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|