C26H19N7O3S — CID 101362134
[7-(4-methoxyphenyl)-2-(4-methylsulfanylphenyl)-6,8-dioxo-5-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene]cyanamide (PubChem CID 101362134) has the molecular formula C26H19N7O3S and a molecular weight of 509.55 g/mol. Its IUPAC name is [7-(4-methoxyphenyl)-2-(4-methylsulfanylphenyl)-6,8-dioxo-5-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene]cyanamide.
| Compound Name | [7-(4-methoxyphenyl)-2-(4-methylsulfanylphenyl)-6,8-dioxo-5-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 101362134 |
| Molecular Formula | C26H19N7O3S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [7-(4-methoxyphenyl)-2-(4-methylsulfanylphenyl)-6,8-dioxo-5-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene]cyanamide |
| SMILES | COc1ccc(-n2c(=O)c3nn(-c4ccc(SC)cc4)/c(=N/C#N)nc3n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C26H19N7O3S/c1-36-20-12-8-18(9-13-20)32-24(34)22-23(31(26(32)35)17-6-4-3-5-7-17)29-25(28-16-27)33(30-22)19-10-14-21(37-2)15-11-19/h3-15H,1-2H3/b28-25+ |
| InChIKey | FZDZRMQDAHXHHZ-AZPGRJICSA-N |
| XLogP | 2.83 |
| TPSA | 120.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|