C25H19N3O4S — CID 1332861
(3R)-1-(4-methoxyphenyl)-3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 1332861) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is (3R)-1-(4-methoxyphenyl)-3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-methoxyphenyl)-3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1332861 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (3R)-1-(4-methoxyphenyl)-3-(4-oxo-3-phenylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@@H](Sc3nc4ccccc4c(=O)n3-c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H19N3O4S/c1-32-18-13-11-17(12-14-18)27-22(29)15-21(24(27)31)33-25-26-20-10-6-5-9-19(20)23(30)28(25)16-7-3-2-4-8-16/h2-14,21H,15H2,1H3/t21-/m1/s1 |
| InChIKey | FHHBFQAUZBJUDP-OAQYLSRUSA-N |
| XLogP | 3.82 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|