C18H14N4O3S — CID 43832746
3-(3-amino-4-oxoquinazolin-2-yl)sulfanyl-1-phenylpyrrolidine-2,5-dione (PubChem CID 43832746) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-(3-amino-4-oxoquinazolin-2-yl)sulfanyl-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-(3-amino-4-oxoquinazolin-2-yl)sulfanyl-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43832746 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-(3-amino-4-oxoquinazolin-2-yl)sulfanyl-1-phenylpyrrolidine-2,5-dione |
| SMILES | Nn1c(SC2CC(=O)N(c3ccccc3)C2=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H14N4O3S/c19-22-16(24)12-8-4-5-9-13(12)20-18(22)26-14-10-15(23)21(17(14)25)11-6-2-1-3-7-11/h1-9,14H,10,19H2 |
| InChIKey | CIEATEFQSHFURA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|