C6H8Cl3NO — CID 101363378
[(2S)-but-3-en-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 101363378) has the molecular formula C6H8Cl3NO and a molecular weight of 216.50 g/mol. Its IUPAC name is [(2S)-but-3-en-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S)-but-3-en-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 101363378 |
| Molecular Formula | C6H8Cl3NO |
| Molecular Weight | 216.50 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | [(2S)-but-3-en-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\O[C@@H](C)C=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3NO/c1-3-4(2)11-5(10)6(7,8)9/h3-4,10H,1H2,2H3/b10-5-/t4-/m0/s1 |
| InChIKey | MATIQTXFEDTUHU-GVWSCFRRSA-N |
| XLogP | 2.92 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|