C27H35NO6 — CID 101363491
[(2R,3R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,4-dioxan-2-yl]-diphenylmethanol (PubChem CID 101363491) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,4-dioxan-2-yl]-diphenylmethanol.
| Compound Name | [(2R,3R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,4-dioxan-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 101363491 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [(2R,3R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]-1,4-dioxan-2-yl]-diphenylmethanol |
| SMILES | CO[C@]1(C)O[C@@H](C(O)(c2ccccc2)c2ccccc2)[C@H](C2=N[C@@H](C(C)C)CO2)O[C@@]1(C)OC |
| InChI | InChI=1S/C27H35NO6/c1-18(2)21-17-32-24(28-21)22-23(34-26(4,31-6)25(3,30-5)33-22)27(29,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23,29H,17H2,1-6H3/t21-,22-,23-,25-,26-/m1/s1 |
| InChIKey | QNEWUBBKOCRLLI-DWTKAHDNSA-N |
| XLogP | 3.88 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |