C24H27N3O — CID 101363803
N-butyl-N,3-diphenyl-5-propan-2-ylpyrazine-2-carboxamide (PubChem CID 101363803) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-butyl-N,3-diphenyl-5-propan-2-ylpyrazine-2-carboxamide.
| Compound Name | N-butyl-N,3-diphenyl-5-propan-2-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 101363803 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-butyl-N,3-diphenyl-5-propan-2-ylpyrazine-2-carboxamide |
| SMILES | CCCCN(C(=O)c1ncc(C(C)C)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O/c1-4-5-16-27(20-14-10-7-11-15-20)24(28)23-22(19-12-8-6-9-13-19)26-21(17-25-23)18(2)3/h6-15,17-18H,4-5,16H2,1-3H3 |
| InChIKey | JSVAFECLZWBJQR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |