C21H22N2O2 — CID 17256808
N-butyl-5-methyl-N,3-diphenyl-1,2-oxazole-4-carboxamide (PubChem CID 17256808) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-butyl-5-methyl-N,3-diphenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-butyl-5-methyl-N,3-diphenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 17256808 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-butyl-5-methyl-N,3-diphenyl-1,2-oxazole-4-carboxamide |
| SMILES | CCCCN(C(=O)c1c(-c2ccccc2)noc1C)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2/c1-3-4-15-23(18-13-9-6-10-14-18)21(24)19-16(2)25-22-20(19)17-11-7-5-8-12-17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | AHBHVYINXYREFO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |