C21H23N3O2 — CID 78801211
N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 78801211) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 78801211 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-19(20(22-26-15)17-8-6-5-7-9-17)21(25)24(4)14-16-10-12-18(13-11-16)23(2)3/h5-13H,14H2,1-4H3 |
| InChIKey | XJCGZXGJBIRGGJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|