C23H25N3O — CID 43035328
N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-6-phenylpyridine-3-carboxamide (PubChem CID 43035328) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-6-phenylpyridine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 43035328 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-6-phenylpyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-17-21(14-15-22(24-17)19-8-6-5-7-9-19)23(27)26(4)16-18-10-12-20(13-11-18)25(2)3/h5-15H,16H2,1-4H3 |
| InChIKey | KRYPLRAERPLTAA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|