C19H32N2O3 — CID 101364174
(4S)-4-butan-2-yl-N-(1-but-3-enylcyclohexanecarbonyl)-1,3-oxazolidine-3-carboxamide (PubChem CID 101364174) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is (4S)-4-butan-2-yl-N-(1-but-3-enylcyclohexanecarbonyl)-1,3-oxazolidine-3-carboxamide.
| Compound Name | (4S)-4-butan-2-yl-N-(1-but-3-enylcyclohexanecarbonyl)-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 101364174 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | (4S)-4-butan-2-yl-N-(1-but-3-enylcyclohexanecarbonyl)-1,3-oxazolidine-3-carboxamide |
| SMILES | C=CCCC1(C(=O)NC(=O)N2COC[C@@H]2C(C)CC)CCCCC1 |
| InChI | InChI=1S/C19H32N2O3/c1-4-6-10-19(11-8-7-9-12-19)17(22)20-18(23)21-14-24-13-16(21)15(3)5-2/h4,15-16H,1,5-14H2,2-3H3,(H,20,22,23)/t15?,16-/m1/s1 |
| InChIKey | YSUXASANBFHBGG-OEMAIJDKSA-N |
| XLogP | 3.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|