About methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate
methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate (PubChem CID 158701514) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate |
| PubChem CID | 158701514 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate |
| SMILES | C=CCCC1(C(=O)OC)CCCC1.COC(=O)C1CCCC1 |
| InChI | InChI=1S/C11H18O2.C7H12O2/c1-3-4-7-11(10(12)13-2)8-5-6-9-11;1-9-7(8)6-4-2-3-5-6/h3H,1,4-9H2,2H3;6H,2-5H2,1H3 |
| InChIKey | IHPHFPWHLQSPEX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate?
The IUPAC name of methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate (CID 158701514) is methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate.
What is the SMILES notation for methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate?
The canonical SMILES for methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate is C=CCCC1(C(=O)OC)CCCC1.COC(=O)C1CCCC1.
What is the InChIKey of methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate?
The InChIKey is IHPHFPWHLQSPEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2.C7H12O2/c1-3-4-7-11(10(12)13-2)8-5-6-9-11;1-9-7(8)6-4-2-3-5-6/h3H,1,4-9H2,2H3;6H,2-5H2,1H3.
What are the key properties of methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate?
methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate has a molecular weight of 310.43 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-but-3-enylcyclopentane-1-carboxylate;methyl cyclopentanecarboxylate is sourced from PubChem (CID 158701514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).