C6H8F2O2 — CID 101364298
(1S,2S)-6,6-difluorocyclohex-3-ene-1,2-diol (PubChem CID 101364298) has the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. Its IUPAC name is (1S,2S)-6,6-difluorocyclohex-3-ene-1,2-diol.
| Compound Name | (1S,2S)-6,6-difluorocyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 101364298 |
| Molecular Formula | C6H8F2O2 |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (1S,2S)-6,6-difluorocyclohex-3-ene-1,2-diol |
| SMILES | O[C@H]1C=CCC(F)(F)[C@H]1O |
| InChI | InChI=1S/C6H8F2O2/c7-6(8)3-1-2-4(9)5(6)10/h1-2,4-5,9-10H,3H2/t4-,5-/m0/s1 |
| InChIKey | JXNYKUHVKCAULM-WHFBIAKZSA-N |
| XLogP | 0.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|