C12H25BO3 — CID 101365439
4,4,5,5-tetramethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3,2-dioxaborolane (PubChem CID 101365439) has the molecular formula C12H25BO3 and a molecular weight of 228.14 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101365439 |
| Molecular Formula | C12H25BO3 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)OCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25BO3/c1-10(2,3)14-9-8-13-15-11(4,5)12(6,7)16-13/h8-9H2,1-7H3 |
| InChIKey | VXZWHRVKOCNUCM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|