About methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate
methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate (PubChem CID 101368177) has the molecular formula C24H22ClN3O2
and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate |
| PubChem CID | 101368177 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate |
| SMILES | COC(=O)C1=NN(c2ccc(Cl)cc2)[C@@H](c2ccccc2)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O2/c1-17(18-9-5-3-6-10-18)27-22(24(29)30-2)26-28(21-15-13-20(25)14-16-21)23(27)19-11-7-4-8-12-19/h3-17,23H,1-2H3/t17-,23-/m0/s1 |
| InChIKey | WQFSDRYCRLPAFR-SBUREZEXSA-N |
| XLogP | 5.41 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate?
The IUPAC name of methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate (CID 101368177) is methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate.
What is the SMILES notation for methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate?
The canonical SMILES for methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate is COC(=O)C1=NN(c2ccc(Cl)cc2)[C@@H](c2ccccc2)N1[C@@H](C)c1ccccc1.
What is the InChIKey of methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate?
The InChIKey is WQFSDRYCRLPAFR-SBUREZEXSA-N. The full InChI is InChI=1S/C24H22ClN3O2/c1-17(18-9-5-3-6-10-18)27-22(24(29)30-2)26-28(21-15-13-20(25)14-16-21)23(27)19-11-7-4-8-12-19/h3-17,23H,1-2H3/t17-,23-/m0/s1.
What are the key properties of methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate?
methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate has a molecular weight of 419.91 g/mol, XLogP of 5.41, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-2-(4-chlorophenyl)-3-phenyl-4-[(1S)-1-phenylethyl]-3H-1,2,4-triazole-5-carboxylate is sourced from PubChem (CID 101368177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).