C24H41NOSi — CID 101369149
(3Z)-N,N-diethyl-3-(2-phenyl-2-trimethylsilylethylidene)nonanamide (PubChem CID 101369149) has the molecular formula C24H41NOSi and a molecular weight of 387.68 g/mol. Its IUPAC name is (3Z)-N,N-diethyl-3-(2-phenyl-2-trimethylsilylethylidene)nonanamide.
| Compound Name | (3Z)-N,N-diethyl-3-(2-phenyl-2-trimethylsilylethylidene)nonanamide |
|---|---|
| PubChem CID | 101369149 |
| Molecular Formula | C24H41NOSi |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | (3Z)-N,N-diethyl-3-(2-phenyl-2-trimethylsilylethylidene)nonanamide |
| SMILES | CCCCCC/C(=C/C(c1ccccc1)[Si](C)(C)C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C24H41NOSi/c1-7-10-11-13-16-21(20-24(26)25(8-2)9-3)19-23(27(4,5)6)22-17-14-12-15-18-22/h12,14-15,17-19,23H,7-11,13,16,20H2,1-6H3/b21-19- |
| InChIKey | IXXBFOQZGLTYLE-VZCXRCSSSA-N |
| XLogP | 6.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|