C15H27NO — CID 101369156
(E)-3-ethenyl-N,N-diethylnon-2-enamide (PubChem CID 101369156) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (E)-3-ethenyl-N,N-diethylnon-2-enamide.
| Compound Name | (E)-3-ethenyl-N,N-diethylnon-2-enamide |
|---|---|
| PubChem CID | 101369156 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (E)-3-ethenyl-N,N-diethylnon-2-enamide |
| SMILES | C=C/C(=C/C(=O)N(CC)CC)CCCCCC |
| InChI | InChI=1S/C15H27NO/c1-5-9-10-11-12-14(6-2)13-15(17)16(7-3)8-4/h6,13H,2,5,7-12H2,1,3-4H3/b14-13- |
| InChIKey | SORXMESMPIQGOJ-YPKPFQOOSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|