C14H25NO — CID 118028564
(2E,4E)-N,N-dimethyldodeca-2,4-dienamide (PubChem CID 118028564) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E,4E)-N,N-dimethyldodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N,N-dimethyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 118028564 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E,4E)-N,N-dimethyldodeca-2,4-dienamide |
| SMILES | CCCCCCC/C=C/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C14H25NO/c1-4-5-6-7-8-9-10-11-12-13-14(16)15(2)3/h10-13H,4-9H2,1-3H3/b11-10+,13-12+ |
| InChIKey | HEKSMTMYGRPVBC-AQASXUMVSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|