C13H21NO — CID 11298718
(2E,4E,8Z)-N,N-dimethylundeca-2,4,8-trienamide (PubChem CID 11298718) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E,4E,8Z)-N,N-dimethylundeca-2,4,8-trienamide.
| Compound Name | (2E,4E,8Z)-N,N-dimethylundeca-2,4,8-trienamide |
|---|---|
| PubChem CID | 11298718 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2E,4E,8Z)-N,N-dimethylundeca-2,4,8-trienamide |
| SMILES | CC/C=C\CC/C=C/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C13H21NO/c1-4-5-6-7-8-9-10-11-12-13(15)14(2)3/h5-6,9-12H,4,7-8H2,1-3H3/b6-5-,10-9+,12-11+ |
| InChIKey | ZCLPWZBAXCWPLJ-NDYRIVJFSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|