C12H21NO — CID 118028568
(2E,4E)-N,N-dimethyldeca-2,4-dienamide (PubChem CID 118028568) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2E,4E)-N,N-dimethyldeca-2,4-dienamide.
| Compound Name | (2E,4E)-N,N-dimethyldeca-2,4-dienamide |
|---|---|
| PubChem CID | 118028568 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2E,4E)-N,N-dimethyldeca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C12H21NO/c1-4-5-6-7-8-9-10-11-12(14)13(2)3/h8-11H,4-7H2,1-3H3/b9-8+,11-10+ |
| InChIKey | AIIWRFGLHPEQEI-BNFZFUHLSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|