C13H23NO2 — CID 102151791
(2E,4E)-N-methoxy-N-methylundeca-2,4-dienamide (PubChem CID 102151791) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (2E,4E)-N-methoxy-N-methylundeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-methoxy-N-methylundeca-2,4-dienamide |
|---|---|
| PubChem CID | 102151791 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2E,4E)-N-methoxy-N-methylundeca-2,4-dienamide |
| SMILES | CCCCCC/C=C/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C13H23NO2/c1-4-5-6-7-8-9-10-11-12-13(15)14(2)16-3/h9-12H,4-8H2,1-3H3/b10-9+,12-11+ |
| InChIKey | GECHZJGFFGSZHW-HULFFUFUSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|