C18H22N2O2Sn — CID 101369346
(E)-1,2-bis(4-methylphenyl)-N,N'-dioxidoethane-1,2-diimine;methane;tin(2+) (PubChem CID 101369346) has the molecular formula C18H22N2O2Sn and a molecular weight of 417.10 g/mol. Its IUPAC name is (E)-1,2-bis(4-methylphenyl)-N,N'-dioxidoethane-1,2-diimine;methane;tin(2+).
| Compound Name | (E)-1,2-bis(4-methylphenyl)-N,N'-dioxidoethane-1,2-diimine;methane;tin(2+) |
|---|---|
| PubChem CID | 101369346 |
| Molecular Formula | C18H22N2O2Sn |
| Molecular Weight | 417.10 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (E)-1,2-bis(4-methylphenyl)-N,N'-dioxidoethane-1,2-diimine;methane;tin(2+) |
| SMILES | C.C.Cc1ccc(C(=N\[O-])/C(=N/[O-])c2ccc(C)cc2)cc1.[Sn+2] |
| InChI | InChI=1S/C16H16N2O2.2CH4.Sn/c1-11-3-7-13(8-4-11)15(17-19)16(18-20)14-9-5-12(2)6-10-14;;;/h3-10,19-20H,1-2H3;2*1H4;/q;;;+2/p-2/b17-15+,18-16+;;; |
| InChIKey | SEFOMIJBSQTWQI-LQCCDGOMSA-L |
| XLogP | 4.47 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|