C14H16O3 — CID 101369730
methyl (1R,2S,3S,7R,8S)-3-methyl-6-oxotricyclo[6.2.1.02,7]undeca-4,9-diene-3-carboxylate (PubChem CID 101369730) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (1R,2S,3S,7R,8S)-3-methyl-6-oxotricyclo[6.2.1.02,7]undeca-4,9-diene-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,7R,8S)-3-methyl-6-oxotricyclo[6.2.1.02,7]undeca-4,9-diene-3-carboxylate |
|---|---|
| PubChem CID | 101369730 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl (1R,2S,3S,7R,8S)-3-methyl-6-oxotricyclo[6.2.1.02,7]undeca-4,9-diene-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C=CC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C14H16O3/c1-14(13(16)17-2)6-5-10(15)11-8-3-4-9(7-8)12(11)14/h3-6,8-9,11-12H,7H2,1-2H3/t8-,9+,11+,12+,14+/m1/s1 |
| InChIKey | DXIDFQLZOSPUAN-NOYZYQNRSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|