C19H24O6S — CID 101369977
(3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-thiophen-2-ylprop-2-ynoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 101369977) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-thiophen-2-ylprop-2-ynoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-thiophen-2-ylprop-2-ynoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 101369977 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-(3-thiophen-2-ylprop-2-ynoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@@H](OCC#Cc3cccs3)[C@H]2O1 |
| InChI | InChI=1S/C19H24O6S/c1-18(2)21-11-13(23-18)14-15(16-17(22-14)25-19(3,4)24-16)20-9-5-7-12-8-6-10-26-12/h6,8,10,13-17H,9,11H2,1-4H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | OVMCTALCDWLVGJ-WRQOLXDDSA-N |
| XLogP | 2.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|