C15H19ClN2 — CID 101370154
1-benzyl-2-(1-chloro-2,2-dimethylpropyl)imidazole (PubChem CID 101370154) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 1-benzyl-2-(1-chloro-2,2-dimethylpropyl)imidazole.
| Compound Name | 1-benzyl-2-(1-chloro-2,2-dimethylpropyl)imidazole |
|---|---|
| PubChem CID | 101370154 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-benzyl-2-(1-chloro-2,2-dimethylpropyl)imidazole |
| SMILES | CC(C)(C)C(Cl)c1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C15H19ClN2/c1-15(2,3)13(16)14-17-9-10-18(14)11-12-7-5-4-6-8-12/h4-10,13H,11H2,1-3H3 |
| InChIKey | ZCRFQXIPUHFWLX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|