C16H23N3O — CID 135256386
1-[(1-benzylimidazol-2-yl)methylamino]-2,2-dimethylpropan-1-ol (PubChem CID 135256386) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[(1-benzylimidazol-2-yl)methylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[(1-benzylimidazol-2-yl)methylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 135256386 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-[(1-benzylimidazol-2-yl)methylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)NCc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C16H23N3O/c1-16(2,3)15(20)18-11-14-17-9-10-19(14)12-13-7-5-4-6-8-13/h4-10,15,18,20H,11-12H2,1-3H3 |
| InChIKey | IKKQXNIQWDIEER-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|