C16H16ClN5 — CID 133324117
N-[(1-benzylimidazol-2-yl)methyl]-6-chloro-2-methylpyrimidin-4-amine (PubChem CID 133324117) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is N-[(1-benzylimidazol-2-yl)methyl]-6-chloro-2-methylpyrimidin-4-amine.
| Compound Name | N-[(1-benzylimidazol-2-yl)methyl]-6-chloro-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133324117 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(1-benzylimidazol-2-yl)methyl]-6-chloro-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(Cl)cc(NCc2nccn2Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H16ClN5/c1-12-20-14(17)9-15(21-12)19-10-16-18-7-8-22(16)11-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,19,20,21) |
| InChIKey | IAZUNTYFPLYADQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |