C21H18FN5 — CID 133324119
N-[(1-benzylimidazol-2-yl)methyl]-6-(4-fluorophenyl)pyridazin-3-amine (PubChem CID 133324119) has the molecular formula C21H18FN5 and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[(1-benzylimidazol-2-yl)methyl]-6-(4-fluorophenyl)pyridazin-3-amine.
| Compound Name | N-[(1-benzylimidazol-2-yl)methyl]-6-(4-fluorophenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133324119 |
| Molecular Formula | C21H18FN5 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[(1-benzylimidazol-2-yl)methyl]-6-(4-fluorophenyl)pyridazin-3-amine |
| SMILES | Fc1ccc(-c2ccc(NCc3nccn3Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C21H18FN5/c22-18-8-6-17(7-9-18)19-10-11-20(26-25-19)24-14-21-23-12-13-27(21)15-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,24,26) |
| InChIKey | YFHDFJBRYWUDKD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |