C17H16F3N5 — CID 133433369
N-[2-(1-benzylimidazol-2-yl)ethyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 133433369) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-2-yl)ethyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133433369 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1ccc(NCCc2nccn2Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H16F3N5/c18-17(19,20)14-6-7-15(24-23-14)21-9-8-16-22-10-11-25(16)12-13-4-2-1-3-5-13/h1-7,10-11H,8-9,12H2,(H,21,24) |
| InChIKey | QFEJHLOSYSCEQP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |