C22H21N3O6 — CID 10137103
(E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxoquinazolin-3-yl]but-2-enoic acid (PubChem CID 10137103) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxoquinazolin-3-yl]but-2-enoic acid.
| Compound Name | (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxoquinazolin-3-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 10137103 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxoquinazolin-3-yl]but-2-enoic acid |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)c(=O)n(C/C=C/C(=O)O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H21N3O6/c1-24-18-10-7-15(20(28)23-13-14-5-8-16(31-2)9-6-14)12-17(18)21(29)25(22(24)30)11-3-4-19(26)27/h3-10,12H,11,13H2,1-2H3,(H,23,28)(H,26,27)/b4-3+ |
| InChIKey | OHEHTDFUSBEUGJ-ONEGZZNKSA-N |
| XLogP | 1.28 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|