C21H21N3O6S — CID 59034422
methyl (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]but-2-enoate (PubChem CID 59034422) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is methyl (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]but-2-enoate |
|---|---|
| PubChem CID | 59034422 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | methyl (E)-4-[6-[(4-methoxyphenyl)methylcarbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/Cn1c(=O)c2cc(C(=O)NCc3ccc(OC)cc3)sc2n(C)c1=O |
| InChI | InChI=1S/C21H21N3O6S/c1-23-20-15(19(27)24(21(23)28)10-4-5-17(25)30-3)11-16(31-20)18(26)22-12-13-6-8-14(29-2)9-7-13/h4-9,11H,10,12H2,1-3H3,(H,22,26)/b5-4+ |
| InChIKey | VFYJDKHWIFIPIH-SNAWJCMRSA-N |
| XLogP | 1.43 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|