C24H31N3O6S — CID 142161536
acetylene;3-[(E)-but-2-enyl]-N-[(2E,5E)-6-methoxy-2-methylhepta-2,5-dienyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide;formic acid (PubChem CID 142161536) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is acetylene;3-[(E)-but-2-enyl]-N-[(2E,5E)-6-methoxy-2-methylhepta-2,5-dienyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide;formic acid.
| Compound Name | acetylene;3-[(E)-but-2-enyl]-N-[(2E,5E)-6-methoxy-2-methylhepta-2,5-dienyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 142161536 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | acetylene;3-[(E)-but-2-enyl]-N-[(2E,5E)-6-methoxy-2-methylhepta-2,5-dienyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide;formic acid |
| SMILES | C#C.C/C=C/Cn1c(=O)c2cc(C(=O)NC/C(C)=C/C/C=C(\C)OC)sc2n(C)c1=O.O=CO |
| InChI | InChI=1S/C21H27N3O4S.C2H2.CH2O2/c1-6-7-11-24-19(26)16-12-17(29-20(16)23(4)21(24)27)18(25)22-13-14(2)9-8-10-15(3)28-5;1-2;2-1-3/h6-7,9-10,12H,8,11,13H2,1-5H3,(H,22,25);1-2H;1H,(H,2,3)/b7-6+,14-9+,15-10+;; |
| InChIKey | GTBKYDIUWCVLHR-MBCJIEADSA-N |
| XLogP | 2.90 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|