C25H25N3O6S — CID 142161539
4-[[6-[[(2E,4E,6Z)-5-methoxyocta-2,4,6-trienyl]carbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoic acid (PubChem CID 142161539) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 4-[[6-[[(2E,4E,6Z)-5-methoxyocta-2,4,6-trienyl]carbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[[(2E,4E,6Z)-5-methoxyocta-2,4,6-trienyl]carbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 142161539 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-[[6-[[(2E,4E,6Z)-5-methoxyocta-2,4,6-trienyl]carbamoyl]-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoic acid |
| SMILES | C/C=C\C(=C/C=C/CNC(=O)c1cc2c(=O)n(Cc3ccc(C(=O)O)cc3)c(=O)n(C)c2s1)OC |
| InChI | InChI=1S/C25H25N3O6S/c1-4-7-18(34-3)8-5-6-13-26-21(29)20-14-19-22(30)28(25(33)27(2)23(19)35-20)15-16-9-11-17(12-10-16)24(31)32/h4-12,14H,13,15H2,1-3H3,(H,26,29)(H,31,32)/b6-5+,7-4-,18-8+ |
| InChIKey | ABOAOQDIVRRJJM-WEUDCBOCSA-N |
| XLogP | 2.90 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|