C26H31N3O7S — CID 142161510
4-[(6-carbamoyl-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl)methyl]benzoic acid;methanol;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 142161510) has the molecular formula C26H31N3O7S and a molecular weight of 529.62 g/mol. Its IUPAC name is 4-[(6-carbamoyl-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl)methyl]benzoic acid;methanol;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | 4-[(6-carbamoyl-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl)methyl]benzoic acid;methanol;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142161510 |
| Molecular Formula | C26H31N3O7S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 4-[(6-carbamoyl-1-methyl-2,4-dioxothieno[2,3-d]pyrimidin-3-yl)methyl]benzoic acid;methanol;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C/C)OC.CO.Cn1c(=O)n(Cc2ccc(C(=O)O)cc2)c(=O)c2cc(C(N)=O)sc21 |
| InChI | InChI=1S/C16H13N3O5S.C9H14O.CH4O/c1-18-14-10(6-11(25-14)12(17)20)13(21)19(16(18)24)7-8-2-4-9(5-3-8)15(22)23;1-5-8(2)6-7-9(3)10-4;1-2/h2-6H,7H2,1H3,(H2,17,20)(H,22,23);5-7H,3H2,1-2,4H3;2H,1H3/b;7-6-,8-5-; |
| InChIKey | UWVYYKGNOZZLAY-FEDOYRPGSA-N |
| XLogP | 2.88 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|