C20H17N3O3S — CID 1251337
N-[(4-methoxyphenyl)methyl]-10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 1251337) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 1251337 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc3c(=O)n4cccc(C)c4nc3s2)cc1 |
| InChI | InChI=1S/C20H17N3O3S/c1-12-4-3-9-23-17(12)22-19-15(20(23)25)10-16(27-19)18(24)21-11-13-5-7-14(26-2)8-6-13/h3-10H,11H2,1-2H3,(H,21,24) |
| InChIKey | PGJASBQHPZAMLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |