C21H20N4O2 — CID 3600771
6,10-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 3600771) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 6,10-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | 6,10-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 3600771 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6,10-dimethyl-N-[(4-methylphenyl)methyl]-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cc3c(=O)n4cccc(C)c4nc3n2C)cc1 |
| InChI | InChI=1S/C21H20N4O2/c1-13-6-8-15(9-7-13)12-22-20(26)17-11-16-19(24(17)3)23-18-14(2)5-4-10-25(18)21(16)27/h4-11H,12H2,1-3H3,(H,22,26) |
| InChIKey | KNKRYTNTSDKLSR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |