C23H23FN4O3 — CID 4908321
N-[(4-fluorophenyl)methyl]-6-(3-methoxypropyl)-10-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 4908321) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-(3-methoxypropyl)-10-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-(3-methoxypropyl)-10-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 4908321 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-(3-methoxypropyl)-10-methyl-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | COCCCn1c(C(=O)NCc2ccc(F)cc2)cc2c(=O)n3cccc(C)c3nc21 |
| InChI | InChI=1S/C23H23FN4O3/c1-15-5-3-10-28-20(15)26-21-18(23(28)30)13-19(27(21)11-4-12-31-2)22(29)25-14-16-6-8-17(24)9-7-16/h3,5-10,13H,4,11-12,14H2,1-2H3,(H,25,29) |
| InChIKey | GIVXDGOZYWQCEC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|