C22H17N3O6S — CID 4169560
dimethyl 2-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzene-1,4-dicarboxylate (PubChem CID 4169560) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is dimethyl 2-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4169560 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | dimethyl 2-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2cc3c(=O)n4cccc(C)c4nc3s2)c1 |
| InChI | InChI=1S/C22H17N3O6S/c1-11-5-4-8-25-17(11)24-19-14(20(25)27)10-16(32-19)18(26)23-15-9-12(21(28)30-2)6-7-13(15)22(29)31-3/h4-10H,1-3H3,(H,23,26) |
| InChIKey | RDZXRVJXSXPXRH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |