C23H21N3O4S — CID 2158492
butyl 4-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzoate (PubChem CID 2158492) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is butyl 4-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2158492 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | butyl 4-[(10-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc3c(=O)n4cccc(C)c4nc3s2)cc1 |
| InChI | InChI=1S/C23H21N3O4S/c1-3-4-12-30-23(29)15-7-9-16(10-8-15)24-20(27)18-13-17-21(31-18)25-19-14(2)6-5-11-26(19)22(17)28/h5-11,13H,3-4,12H2,1-2H3,(H,24,27) |
| InChIKey | VHFPCHCXPFXUBV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|